SS Filter Cartridge for High Filtering Precision
| Condition:New | Type:Water Softener | Medium Material:PP | Place of Origin:Shaanxi China (Mainland) |
| Brand Name:Qixin | Model Number:QX-T | Porosity:28%-50% | Aperture(micron):4-160 |
| Filtration precision(micron):0.2-100 | Application:Industry,medical,food | Thickness:3mm | Length:≥1200mm |
| Width:≥1000mm | Grade:S304 S304L S316 S316L | Technique:Sintered | Powder Or Not:Not Powder |

1.Characteristic
SS Filter Cartridge | |
| Porosity | 28%-50% |
| Aperture(μm) | 4-160 |
| Filtration precision(μm) | 0.2-100 |
| Material quality | S304 S304L S316 S316L |
| Compressive strength | 3Mpa/cm2 |
| Shape | Plate,flakiness,disc,ring,bar,cone |
| Property | 1)Channel crisscrossed,High temperature resistance,resistance to thermal shock. 2)Corrosion resistant,applicable to a variety of acid alkali and corrosive medium,Stainless steel filter can resist the corrosion of acid and alkali and organic matter, especially suitable for sour gas filtration. 3)High strength, good toughness, suitable for high pressure environment. 4)weldable,easy loading and unloading. 5)Hole shape stability, uniform distribution, guarantee the stability of filtering performance. 6)The regeneration performance is good. 7)Filtration performance after repeated washing of regeneration to restore more than 90% |
| Work environment | Nitric acid, sulfuric acid, acetic acid, oxalic acid, phosphoric acid, 5% hydrochloric acid, molten sodium, liquid hydrogen, nitrogen, hydrogen sulfide, acetylene, water vapor, hydrogen gas, carbon dioxide gas |
| Application | 1)High pressure filter medium;oilfield oil sands separation; 2)Machinery, ships, fuel, lubricating oil, hydraulic start oil filter; 3)Chemical industry, chemical plants process; 4)High temperature gas dust removal; filter food; medical filter; 5)Water treatment and distribution,gas distributionsystem and the fluidized bed. |
2.Technical parameters( Allow ≤600°Cthe conditions of using)
| Filtering level | Filtering precision (μm) | Maximum Aperture (μm) | Permeability (10-12m2) | Air permeability (m3/h.m2.kpa) | Thickness (mm) | Compressive strength (Mpa/cm2) | Bubbling pressure (kpa) |
| S9 | 0.2 | 2.5 | 1 | 3 | 3 | ||
| S8 | 0.5 | 4 | 3 | 3 | 3 | ||
| S7 | 1 | 6 | 5 | 3 | 3 | ||
| S6 | 2.5 | 10 | 0.09 | 10 | 3 | 3 | 9.16 |
| S5 | 5 | 15 | 0.23 | 40 | 3 | 3 | 6.1 |
| 8 | 20 | 0.91 | 80 | 3 | 3 | 4.6 | |
| S4 | 10 | 30 | 1.81 | 160 | 3 | 3 | 2.6 |
| S3 | 28 | 60 | 3.82 | 350 | 3 | 3 | 1.8 |
| 35 | 80 | 7.29 | 500 | 3 | 3 | 1.4 | |
| S2 | 40 | 100 | 9.43 | 700 | 3 | 3 | 1.1 |
| S1 | 65 | 160 | 15.1 | 1000 | 3 | 3 | 0.66 |
3.Product Display
Baoji Qixin Titanium Co,. Ltd is located in "The Chinese Titanium Valley" who has specialized in Titanium Anode and Titanium Material for 10 yeas old.

| Packaging Detail:Plastic or paper as inside,carton or plywood case as outside,or as clients' demands |
| Delivery Detail:5-10days,or provide you the exact time after get your inquiry |

